C20H28O3 — CID 25105662
[(4R,6R)-6-phenylmethoxydec-1-en-4-yl] prop-2-enoate (PubChem CID 25105662) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(4R,6R)-6-phenylmethoxydec-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,6R)-6-phenylmethoxydec-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 25105662 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [(4R,6R)-6-phenylmethoxydec-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](C[C@@H](CCCC)OCc1ccccc1)OC(=O)C=C |
| InChI | InChI=1S/C20H28O3/c1-4-7-14-18(22-16-17-12-9-8-10-13-17)15-19(11-5-2)23-20(21)6-3/h5-6,8-10,12-13,18-19H,2-4,7,11,14-16H2,1H3/t18-,19-/m1/s1 |
| InChIKey | DAWDRNSGDZXTNS-RTBURBONSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|