C26H46O3Si — CID 102465931
tert-butyl-dimethyl-(6-phenylmethoxytridec-1-en-4-ylperoxy)silane (PubChem CID 102465931) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-(6-phenylmethoxytridec-1-en-4-ylperoxy)silane.
| Compound Name | tert-butyl-dimethyl-(6-phenylmethoxytridec-1-en-4-ylperoxy)silane |
|---|---|
| PubChem CID | 102465931 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | tert-butyl-dimethyl-(6-phenylmethoxytridec-1-en-4-ylperoxy)silane |
| SMILES | C=CCC(CC(CCCCCCC)OCc1ccccc1)OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O3Si/c1-8-10-11-12-16-20-24(27-22-23-18-14-13-15-19-23)21-25(17-9-2)28-29-30(6,7)26(3,4)5/h9,13-15,18-19,24-25H,2,8,10-12,16-17,20-22H2,1,3-7H3 |
| InChIKey | HWTLKJQZKZUBST-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|