C27H38O4Si — CID 24997824
phenyl (3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyoct-7-enoate (PubChem CID 24997824) has the molecular formula C27H38O4Si and a molecular weight of 454.68 g/mol. Its IUPAC name is phenyl (3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyoct-7-enoate.
| Compound Name | phenyl (3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyoct-7-enoate |
|---|---|
| PubChem CID | 24997824 |
| Molecular Formula | C27H38O4Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | phenyl (3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyoct-7-enoate |
| SMILES | C=CC[C@@H](C[C@H](CC(=O)Oc1ccccc1)O[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C27H38O4Si/c1-7-14-24(29-21-22-15-10-8-11-16-22)19-25(31-32(5,6)27(2,3)4)20-26(28)30-23-17-12-9-13-18-23/h7-13,15-18,24-25H,1,14,19-21H2,2-6H3/t24-,25+/m0/s1 |
| InChIKey | LTAUFXNLXIYCPN-LOSJGSFVSA-N |
| XLogP | 6.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|