C23H34O3Si — CID 101366605
[(2S)-1-phenylpent-4-en-2-yl] (3E)-3-[tert-butyl(dimethyl)silyl]oxyhexa-3,5-dienoate (PubChem CID 101366605) has the molecular formula C23H34O3Si and a molecular weight of 386.61 g/mol. Its IUPAC name is [(2S)-1-phenylpent-4-en-2-yl] (3E)-3-[tert-butyl(dimethyl)silyl]oxyhexa-3,5-dienoate.
| Compound Name | [(2S)-1-phenylpent-4-en-2-yl] (3E)-3-[tert-butyl(dimethyl)silyl]oxyhexa-3,5-dienoate |
|---|---|
| PubChem CID | 101366605 |
| Molecular Formula | C23H34O3Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [(2S)-1-phenylpent-4-en-2-yl] (3E)-3-[tert-butyl(dimethyl)silyl]oxyhexa-3,5-dienoate |
| SMILES | C=C/C=C(\CC(=O)O[C@@H](CC=C)Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H34O3Si/c1-8-13-20(17-19-15-11-10-12-16-19)25-22(24)18-21(14-9-2)26-27(6,7)23(3,4)5/h8-12,14-16,20H,1-2,13,17-18H2,3-7H3/b21-14+/t20-/m0/s1 |
| InChIKey | MJDCAGNJPVNKIK-LQOIVRHRSA-N |
| XLogP | 6.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|