C22H41NO2Si2 — CID 91753830
[tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]-methylamino]-3-phenylpropanoate (PubChem CID 91753830) has the molecular formula C22H41NO2Si2 and a molecular weight of 407.75 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]-methylamino]-3-phenylpropanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]-methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91753830 |
| Molecular Formula | C22H41NO2Si2 |
| Molecular Weight | 407.75 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[[tert-butyl(dimethyl)silyl]-methylamino]-3-phenylpropanoate |
| SMILES | CN(C(Cc1ccccc1)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41NO2Si2/c1-21(2,3)26(8,9)23(7)19(17-18-15-13-12-14-16-18)20(24)25-27(10,11)22(4,5)6/h12-16,19H,17H2,1-11H3 |
| InChIKey | LISJRGNNQLVFNX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.75 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|