C27H43NO4Si2 — CID 91742096
[tert-butyl(dimethyl)silyl] 2-amino-3-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]phenyl]propanoate (PubChem CID 91742096) has the molecular formula C27H43NO4Si2 and a molecular weight of 501.82 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-amino-3-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]phenyl]propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-amino-3-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 91742096 |
| Molecular Formula | C27H43NO4Si2 |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-amino-3-[4-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]phenyl]propanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C(N)Cc1ccc(Oc2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H43NO4Si2/c1-26(2,3)33(7,8)31-23-17-15-22(16-18-23)30-21-13-11-20(12-14-21)19-24(28)25(29)32-34(9,10)27(4,5)6/h11-18,24H,19,28H2,1-10H3 |
| InChIKey | ISMWHCGROLVCOJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|