C19H34NO4PSi — CID 58787911
N-[(2R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-dimethylphosphoryloxypropan-2-yl]acetamide (PubChem CID 58787911) has the molecular formula C19H34NO4PSi and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[(2R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-dimethylphosphoryloxypropan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-dimethylphosphoryloxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 58787911 |
| Molecular Formula | C19H34NO4PSi |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[(2R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-dimethylphosphoryloxypropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](COP(C)(C)=O)Cc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H34NO4PSi/c1-15(21)20-17(14-23-25(5,6)22)13-16-9-11-18(12-10-16)24-26(7,8)19(2,3)4/h9-12,17H,13-14H2,1-8H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | MVOWPSICWKHQMV-QGZVFWFLSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|