C24H30N2O5Si — CID 174189114
[(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid (PubChem CID 174189114) has the molecular formula C24H30N2O5Si and a molecular weight of 454.60 g/mol. Its IUPAC name is [(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174189114 |
| Molecular Formula | C24H30N2O5Si |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C[C@@H](CN2C(=O)c3ccccc3C2=O)NC(=O)O)cc1 |
| InChI | InChI=1S/C24H30N2O5Si/c1-24(2,3)32(4,5)31-18-12-10-16(11-13-18)14-17(25-23(29)30)15-26-21(27)19-8-6-7-9-20(19)22(26)28/h6-13,17,25H,14-15H2,1-5H3,(H,29,30)/t17-/m0/s1 |
| InChIKey | UBBXTNLEDNIDQQ-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|