C29H37N3O7Si — CID 174189073
tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-3-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-6-yl]propan-2-yl]carbamate (PubChem CID 174189073) has the molecular formula C29H37N3O7Si and a molecular weight of 567.72 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-3-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-6-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-3-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-6-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 174189073 |
| Molecular Formula | C29H37N3O7Si |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-3-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-6-yl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc2c(c1)oc(=O)n2COCC[Si](C)(C)C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H37N3O7Si/c1-29(2,3)39-27(35)30-20(17-31-25(33)21-9-7-8-10-22(21)26(31)34)15-19-11-12-23-24(16-19)38-28(36)32(23)18-37-13-14-40(4,5)6/h7-12,16,20H,13-15,17-18H2,1-6H3,(H,30,35) |
| InChIKey | MBECPTUSNJQZDX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|