C24H30N2O5Si — CID 177251419
6-[[(1S)-6-methoxy-1-methyl-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one (PubChem CID 177251419) has the molecular formula C24H30N2O5Si and a molecular weight of 454.60 g/mol. Its IUPAC name is 6-[[(1S)-6-methoxy-1-methyl-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one.
| Compound Name | 6-[[(1S)-6-methoxy-1-methyl-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 177251419 |
| Molecular Formula | C24H30N2O5Si |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 6-[[(1S)-6-methoxy-1-methyl-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
| SMILES | COc1ccc2c(c1)[C@H](C)N(Cc1ccc3c(c1)oc(=O)n3COCC[Si](C)(C)C)C2=O |
| InChI | InChI=1S/C24H30N2O5Si/c1-16-20-13-18(29-2)7-8-19(20)23(27)25(16)14-17-6-9-21-22(12-17)31-24(28)26(21)15-30-10-11-32(3,4)5/h6-9,12-13,16H,10-11,14-15H2,1-5H3/t16-/m0/s1 |
| InChIKey | AXAMUZAFWAREAH-INIZCTEOSA-N |
| XLogP | 4.63 |
| TPSA | 73.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|