C23H28N2O5Si — CID 177306896
4-[[1-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one (PubChem CID 177306896) has the molecular formula C23H28N2O5Si and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[[1-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one.
| Compound Name | 4-[[1-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 177306896 |
| Molecular Formula | C23H28N2O5Si |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[[1-(hydroxymethyl)-3-oxo-1H-isoindol-2-yl]methyl]-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(=O)oc2cccc(CN3C(=O)c4ccccc4C3CO)c21 |
| InChI | InChI=1S/C23H28N2O5Si/c1-31(2,3)12-11-29-15-25-21-16(7-6-10-20(21)30-23(25)28)13-24-19(14-26)17-8-4-5-9-18(17)22(24)27/h4-10,19,26H,11-15H2,1-3H3 |
| InChIKey | GDNOBSASJDZUIL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|