C16H25BrN2O2Si — CID 68503428
4-(bromomethyl)-1-ethyl-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one (PubChem CID 68503428) has the molecular formula C16H25BrN2O2Si and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-(bromomethyl)-1-ethyl-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one.
| Compound Name | 4-(bromomethyl)-1-ethyl-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 68503428 |
| Molecular Formula | C16H25BrN2O2Si |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-(bromomethyl)-1-ethyl-3-(2-trimethylsilylethoxymethyl)benzimidazol-2-one |
| SMILES | CCn1c(=O)n(COCC[Si](C)(C)C)c2c(CBr)cccc21 |
| InChI | InChI=1S/C16H25BrN2O2Si/c1-5-18-14-8-6-7-13(11-17)15(14)19(16(18)20)12-21-9-10-22(2,3)4/h6-8H,5,9-12H2,1-4H3 |
| InChIKey | KGYQKHTWLKPSBK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|