C26H36N2O5SSi — CID 169121092
[3-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]cyclobutyl]methyl 4-methylbenzenesulfonate (PubChem CID 169121092) has the molecular formula C26H36N2O5SSi and a molecular weight of 516.74 g/mol. Its IUPAC name is [3-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]cyclobutyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]cyclobutyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169121092 |
| Molecular Formula | C26H36N2O5SSi |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [3-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-yl]cyclobutyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(c3cccc4c3n(C)c(=O)n4COCC[Si](C)(C)C)C2)cc1 |
| InChI | InChI=1S/C26H36N2O5SSi/c1-19-9-11-22(12-10-19)34(30,31)33-17-20-15-21(16-20)23-7-6-8-24-25(23)27(2)26(29)28(24)18-32-13-14-35(3,4)5/h6-12,20-21H,13-18H2,1-5H3 |
| InChIKey | KOKBXGKUXKIXDI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|