C12H21BrN2O3Si — CID 123772393
6-bromo-1,5-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione (PubChem CID 123772393) has the molecular formula C12H21BrN2O3Si and a molecular weight of 349.30 g/mol. Its IUPAC name is 6-bromo-1,5-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 6-bromo-1,5-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123772393 |
| Molecular Formula | C12H21BrN2O3Si |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 6-bromo-1,5-dimethyl-3-(2-trimethylsilylethoxymethyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(Br)n(C)c(=O)n(COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C12H21BrN2O3Si/c1-9-10(13)14(2)12(17)15(11(9)16)8-18-6-7-19(3,4)5/h6-8H2,1-5H3 |
| InChIKey | YAMWBZJVKQUGRK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|