C16H27BrN4O3Si — CID 90440986
8-bromo-1-butyl-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90440986) has the molecular formula C16H27BrN4O3Si and a molecular weight of 431.41 g/mol. Its IUPAC name is 8-bromo-1-butyl-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-bromo-1-butyl-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90440986 |
| Molecular Formula | C16H27BrN4O3Si |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 8-bromo-1-butyl-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2c(nc(Br)n2COCC[Si](C)(C)C)n(C)c1=O |
| InChI | InChI=1S/C16H27BrN4O3Si/c1-6-7-8-20-14(22)12-13(19(2)16(20)23)18-15(17)21(12)11-24-9-10-25(3,4)5/h6-11H2,1-5H3 |
| InChIKey | WYDIYDOOMQUKSI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|