C15H23ClN4O3Si — CID 59299565
8-chloro-1-methyl-7-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 59299565) has the molecular formula C15H23ClN4O3Si and a molecular weight of 370.91 g/mol. Its IUPAC name is 8-chloro-1-methyl-7-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-chloro-1-methyl-7-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 59299565 |
| Molecular Formula | C15H23ClN4O3Si |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 8-chloro-1-methyl-7-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | C=CCn1c(Cl)nc2c1c(=O)n(C)c(=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H23ClN4O3Si/c1-6-7-19-11-12(17-14(19)16)20(15(22)18(2)13(11)21)10-23-8-9-24(3,4)5/h6H,1,7-10H2,2-5H3 |
| InChIKey | NAKWNXNAVSVBQI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|