C22H33ClIN3O3Si2 — CID 171842684
8-chloro-7-iodo-1,3-bis(2-trimethylsilylethoxymethyl)imidazo[4,5-b]quinolin-2-one (PubChem CID 171842684) has the molecular formula C22H33ClIN3O3Si2 and a molecular weight of 606.05 g/mol. Its IUPAC name is 8-chloro-7-iodo-1,3-bis(2-trimethylsilylethoxymethyl)imidazo[4,5-b]quinolin-2-one.
| Compound Name | 8-chloro-7-iodo-1,3-bis(2-trimethylsilylethoxymethyl)imidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 171842684 |
| Molecular Formula | C22H33ClIN3O3Si2 |
| Molecular Weight | 606.05 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | 8-chloro-7-iodo-1,3-bis(2-trimethylsilylethoxymethyl)imidazo[4,5-b]quinolin-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(=O)n(COCC[Si](C)(C)C)c2nc3ccc(I)c(Cl)c3cc21 |
| InChI | InChI=1S/C22H33ClIN3O3Si2/c1-31(2,3)11-9-29-14-26-19-13-16-18(8-7-17(24)20(16)23)25-21(19)27(22(26)28)15-30-10-12-32(4,5)6/h7-8,13H,9-12,14-15H2,1-6H3 |
| InChIKey | BALMSMMAKXJYSG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.05 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|