C13H20ClN3OSi — CID 77230728
2-[(4-chloro-6-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane (PubChem CID 77230728) has the molecular formula C13H20ClN3OSi and a molecular weight of 297.86 g/mol. Its IUPAC name is 2-[(4-chloro-6-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-chloro-6-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 77230728 |
| Molecular Formula | C13H20ClN3OSi |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[(4-chloro-6-methylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc2c(Cl)ncnc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C13H20ClN3OSi/c1-10-7-11-12(14)15-8-16-13(11)17(10)9-18-5-6-19(2,3)4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | NXXARPSAIVBWCZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|