C19H23ClN2OSi — CID 58368344
2-[(4-chloro-2-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 58368344) has the molecular formula C19H23ClN2OSi and a molecular weight of 358.94 g/mol. Its IUPAC name is 2-[(4-chloro-2-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-chloro-2-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58368344 |
| Molecular Formula | C19H23ClN2OSi |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[(4-chloro-2-phenylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccccc2)cc2c(Cl)ccnc21 |
| InChI | InChI=1S/C19H23ClN2OSi/c1-24(2,3)12-11-23-14-22-18(15-7-5-4-6-8-15)13-16-17(20)9-10-21-19(16)22/h4-10,13H,11-12,14H2,1-3H3 |
| InChIKey | QKGPDXCVOSKXPR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|