C27H35N5O2Si — CID 171513346
[4-[4-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methanol (PubChem CID 171513346) has the molecular formula C27H35N5O2Si and a molecular weight of 489.70 g/mol. Its IUPAC name is [4-[4-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methanol.
| Compound Name | [4-[4-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methanol |
|---|---|
| PubChem CID | 171513346 |
| Molecular Formula | C27H35N5O2Si |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | [4-[4-[methyl-[(6-methyl-2-pyridinyl)methyl]amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methanol |
| SMILES | Cc1cccc(CN(C)c2ncnc3c2cc(-c2ccc(CO)cc2)n3COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C27H35N5O2Si/c1-20-7-6-8-23(30-20)16-31(2)26-24-15-25(22-11-9-21(17-33)10-12-22)32(27(24)29-18-28-26)19-34-13-14-35(3,4)5/h6-12,15,18,33H,13-14,16-17,19H2,1-5H3 |
| InChIKey | UQGPOOWKXGKBNA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|