C37H40FN3O4Si — CID 58272144
1-cyclopropyl-3-[2-fluoro-4-[6-(4-phenylmethoxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]propan-2-one (PubChem CID 58272144) has the molecular formula C37H40FN3O4Si and a molecular weight of 637.83 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-fluoro-4-[6-(4-phenylmethoxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]propan-2-one.
| Compound Name | 1-cyclopropyl-3-[2-fluoro-4-[6-(4-phenylmethoxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]propan-2-one |
|---|---|
| PubChem CID | 58272144 |
| Molecular Formula | C37H40FN3O4Si |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | 1-cyclopropyl-3-[2-fluoro-4-[6-(4-phenylmethoxyphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]oxyphenyl]propan-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(OCc3ccccc3)cc2)cc2c(Oc3ccc(CC(=O)CC4CC4)c(F)c3)ncnc21 |
| InChI | InChI=1S/C37H40FN3O4Si/c1-46(2,3)18-17-43-25-41-35(28-11-14-31(15-12-28)44-23-27-7-5-4-6-8-27)22-33-36(41)39-24-40-37(33)45-32-16-13-29(34(38)21-32)20-30(42)19-26-9-10-26/h4-8,11-16,21-22,24,26H,9-10,17-20,23,25H2,1-3H3 |
| InChIKey | IAQFXIJTKITBLO-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|