C35H48BN5O6SSi — CID 171431626
N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (PubChem CID 171431626) has the molecular formula C35H48BN5O6SSi and a molecular weight of 705.76 g/mol. Its IUPAC name is N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 171431626 |
| Molecular Formula | C35H48BN5O6SSi |
| Molecular Weight | 705.76 g/mol |
| Exact Mass | 705.32 |
| IUPAC Name | N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| SMILES | CC1(C)OB(c2ccc(CS(=O)(=O)Nc3ccc(-c4cc5c(N6CCOCC6)ncnc5n4COCC[Si](C)(C)C)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C35H48BN5O6SSi/c1-34(2)35(3,4)47-36(46-34)28-12-8-26(9-13-28)23-48(42,43)39-29-14-10-27(11-15-29)31-22-30-32(40-16-18-44-19-17-40)37-24-38-33(30)41(31)25-45-20-21-49(5,6)7/h8-15,22,24,39H,16-21,23,25H2,1-7H3 |
| InChIKey | FODHRMKYKFXGRW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.76 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|