C36H52N6O5Si — CID 176549758
tert-butyl 7-[[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]carbamoyl]-2-azaspiro[3.5]nonane-2-carboxylate (PubChem CID 176549758) has the molecular formula C36H52N6O5Si and a molecular weight of 676.93 g/mol. Its IUPAC name is tert-butyl 7-[[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]carbamoyl]-2-azaspiro[3.5]nonane-2-carboxylate.
| Compound Name | tert-butyl 7-[[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]carbamoyl]-2-azaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 176549758 |
| Molecular Formula | C36H52N6O5Si |
| Molecular Weight | 676.93 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | tert-butyl 7-[[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]carbamoyl]-2-azaspiro[3.5]nonane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC(C(=O)Nc3ccc(-c4cc5c(N6CCOCC6)ncnc5n4COCC[Si](C)(C)C)cc3)CC2)C1 |
| InChI | InChI=1S/C36H52N6O5Si/c1-35(2,3)47-34(44)41-22-36(23-41)13-11-27(12-14-36)33(43)39-28-9-7-26(8-10-28)30-21-29-31(40-15-17-45-18-16-40)37-24-38-32(29)42(30)25-46-19-20-48(4,5)6/h7-10,21,24,27H,11-20,22-23,25H2,1-6H3,(H,39,43) |
| InChIKey | CTPAYOSDYIXENX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.93 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|