C28H34N6O5SSi — CID 164539191
4-formyl-N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pyridine-2-sulfonamide (PubChem CID 164539191) has the molecular formula C28H34N6O5SSi and a molecular weight of 594.77 g/mol. Its IUPAC name is 4-formyl-N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pyridine-2-sulfonamide.
| Compound Name | 4-formyl-N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 164539191 |
| Molecular Formula | C28H34N6O5SSi |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 4-formyl-N-[4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]pyridine-2-sulfonamide |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(NS(=O)(=O)c3cc(C=O)ccn3)cc2)cc2c(N3CCOCC3)ncnc21 |
| InChI | InChI=1S/C28H34N6O5SSi/c1-41(2,3)15-14-39-20-34-25(17-24-27(30-19-31-28(24)34)33-10-12-38-13-11-33)22-4-6-23(7-5-22)32-40(36,37)26-16-21(18-35)8-9-29-26/h4-9,16-19,32H,10-15,20H2,1-3H3 |
| InChIKey | CULHWOPURKKSEQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|