C21H30N6O2Si — CID 164539155
6-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]pyridin-3-amine (PubChem CID 164539155) has the molecular formula C21H30N6O2Si and a molecular weight of 426.60 g/mol. Its IUPAC name is 6-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]pyridin-3-amine.
| Compound Name | 6-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 164539155 |
| Molecular Formula | C21H30N6O2Si |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]pyridin-3-amine |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(N)cn2)cc2c(N3CCOCC3)ncnc21 |
| InChI | InChI=1S/C21H30N6O2Si/c1-30(2,3)11-10-29-15-27-19(18-5-4-16(22)13-23-18)12-17-20(24-14-25-21(17)27)26-6-8-28-9-7-26/h4-5,12-14H,6-11,15,22H2,1-3H3 |
| InChIKey | SOTKVOOXQLJLRW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|