C19H30N4O3Si — CID 123685712
5-ethyl-4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 123685712) has the molecular formula C19H30N4O3Si and a molecular weight of 390.56 g/mol. Its IUPAC name is 5-ethyl-4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 5-ethyl-4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 123685712 |
| Molecular Formula | C19H30N4O3Si |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 5-ethyl-4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | CCc1c(C=O)n(COCC[Si](C)(C)C)c2ncnc(N3CCOCC3)c12 |
| InChI | InChI=1S/C19H30N4O3Si/c1-5-15-16(12-24)23(14-26-10-11-27(2,3)4)19-17(15)18(20-13-21-19)22-6-8-25-9-7-22/h12-13H,5-11,14H2,1-4H3 |
| InChIKey | MHCPWNFZIACJRZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|