C30H35N5O3Si — CID 171431601
N-[4-[2-[4-[4-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 171431601) has the molecular formula C30H35N5O3Si and a molecular weight of 541.73 g/mol. Its IUPAC name is N-[4-[2-[4-[4-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[4-[4-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171431601 |
| Molecular Formula | C30H35N5O3Si |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-[4-[2-[4-[4-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)Nc2ccc(-c3cc4c(C)ncnc4n3COCC[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H35N5O3Si/c1-6-28(36)33-24-11-7-22(8-12-24)17-29(37)34-25-13-9-23(10-14-25)27-18-26-21(2)31-19-32-30(26)35(27)20-38-15-16-39(3,4)5/h6-14,18-19H,1,15-17,20H2,2-5H3,(H,33,36)(H,34,37) |
| InChIKey | NSIQBARLSDMKSG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|