C21H25ClN4O2Si — CID 90096094
N-[3-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 90096094) has the molecular formula C21H25ClN4O2Si and a molecular weight of 429.00 g/mol. Its IUPAC name is N-[3-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90096094 |
| Molecular Formula | C21H25ClN4O2Si |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[3-[2-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Cl)nc3c2ccn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C21H25ClN4O2Si/c1-5-18(27)23-16-8-6-7-15(13-16)19-17-9-10-26(20(17)25-21(22)24-19)14-28-11-12-29(2,3)4/h5-10,13H,1,11-12,14H2,2-4H3,(H,23,27) |
| InChIKey | UFQUQWDNPAXBHA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|