C28H36N6O4Si — CID 141450300
N-[3-[7-[1-(2-ethoxyethyl)pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide (PubChem CID 141450300) has the molecular formula C28H36N6O4Si and a molecular weight of 548.72 g/mol. Its IUPAC name is N-[3-[7-[1-(2-ethoxyethyl)pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[1-(2-ethoxyethyl)pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 141450300 |
| Molecular Formula | C28H36N6O4Si |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | N-[3-[7-[1-(2-ethoxyethyl)pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3c(n2)c(-c2cnn(CCOCC)c2)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C28H36N6O4Si/c1-6-25(35)31-22-9-8-10-23(15-22)38-26-17-29-28-27(32-26)24(19-33(28)20-37-13-14-39(3,4)5)21-16-30-34(18-21)11-12-36-7-2/h6,8-10,15-19H,1,7,11-14,20H2,2-5H3,(H,31,35) |
| InChIKey | IOGIUNNLLMXEJW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|