C32H33F3N6O3Si — CID 141450386
N-[3-[7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide (PubChem CID 141450386) has the molecular formula C32H33F3N6O3Si and a molecular weight of 634.74 g/mol. Its IUPAC name is N-[3-[7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 141450386 |
| Molecular Formula | C32H33F3N6O3Si |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | N-[3-[7-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3c(n2)c(-c2cnn(Cc4ccc(C(F)(F)F)cc4)c2)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C32H33F3N6O3Si/c1-5-28(42)38-25-7-6-8-26(15-25)44-29-17-36-31-30(39-29)27(20-40(31)21-43-13-14-45(2,3)4)23-16-37-41(19-23)18-22-9-11-24(12-10-22)32(33,34)35/h5-12,15-17,19-20H,1,13-14,18,21H2,2-4H3,(H,38,42) |
| InChIKey | RNEBHYXNXZIBGB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|