C22H19N5O2 — CID 118641812
N-[3-[[7-[4-(aminomethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide (PubChem CID 118641812) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[3-[[7-[4-(aminomethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[7-[4-(aminomethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118641812 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[3-[[7-[4-(aminomethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3[nH]cc(-c4ccc(CN)cc4)c3n2)c1 |
| InChI | InChI=1S/C22H19N5O2/c1-2-19(28)26-16-4-3-5-17(10-16)29-20-13-25-22-21(27-20)18(12-24-22)15-8-6-14(11-23)7-9-15/h2-10,12-13H,1,11,23H2,(H,24,25)(H,26,28) |
| InChIKey | JYPDBZRQVBAFHS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|