C24H17FN6O3 — CID 118641519
N-(cyanomethyl)-2-fluoro-5-[2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazin-7-yl]benzamide (PubChem CID 118641519) has the molecular formula C24H17FN6O3 and a molecular weight of 456.44 g/mol. Its IUPAC name is N-(cyanomethyl)-2-fluoro-5-[2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazin-7-yl]benzamide.
| Compound Name | N-(cyanomethyl)-2-fluoro-5-[2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazin-7-yl]benzamide |
|---|---|
| PubChem CID | 118641519 |
| Molecular Formula | C24H17FN6O3 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-(cyanomethyl)-2-fluoro-5-[2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazin-7-yl]benzamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3[nH]cc(-c4ccc(F)c(C(=O)NCC#N)c4)c3n2)c1 |
| InChI | InChI=1S/C24H17FN6O3/c1-2-20(32)30-15-4-3-5-16(11-15)34-21-13-29-23-22(31-21)18(12-28-23)14-6-7-19(25)17(10-14)24(33)27-9-8-26/h2-7,10-13H,1,9H2,(H,27,33)(H,28,29)(H,30,32) |
| InChIKey | PWRZXWWURYVFQU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|