C23H19N7O2 — CID 118641690
N-[3-[[7-[4-(2-cyanoethylamino)-2-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide (PubChem CID 118641690) has the molecular formula C23H19N7O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-[3-[[7-[4-(2-cyanoethylamino)-2-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[7-[4-(2-cyanoethylamino)-2-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118641690 |
| Molecular Formula | C23H19N7O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[3-[[7-[4-(2-cyanoethylamino)-2-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3[nH]cc(-c4cc(NCCC#N)ccn4)c3n2)c1 |
| InChI | InChI=1S/C23H19N7O2/c1-2-20(31)29-16-5-3-6-17(11-16)32-21-14-28-23-22(30-21)18(13-27-23)19-12-15(7-10-26-19)25-9-4-8-24/h2-3,5-7,10-14H,1,4,9H2,(H,25,26)(H,27,28)(H,29,31) |
| InChIKey | QAVFVTNRCZWKQO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|