C25H18N6O2 — CID 118641473
N-[3-[[7-(6-pyridin-4-yl-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide (PubChem CID 118641473) has the molecular formula C25H18N6O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[3-[[7-(6-pyridin-4-yl-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[7-(6-pyridin-4-yl-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118641473 |
| Molecular Formula | C25H18N6O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[3-[[7-(6-pyridin-4-yl-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3[nH]cc(-c4ccc(-c5ccncc5)nc4)c3n2)c1 |
| InChI | InChI=1S/C25H18N6O2/c1-2-22(32)30-18-4-3-5-19(12-18)33-23-15-29-25-24(31-23)20(14-28-25)17-6-7-21(27-13-17)16-8-10-26-11-9-16/h2-15H,1H2,(H,28,29)(H,30,32) |
| InChIKey | BKFBVDSGSQMUMB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|