C23H29N5O3Si — CID 175886392
N-methyl-5-[3-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide (PubChem CID 175886392) has the molecular formula C23H29N5O3Si and a molecular weight of 451.60 g/mol. Its IUPAC name is N-methyl-5-[3-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide.
| Compound Name | N-methyl-5-[3-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175886392 |
| Molecular Formula | C23H29N5O3Si |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-methyl-5-[3-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cc3c(C(=O)NC)nn(COCC[Si](C)(C)C)c3cn2)c1 |
| InChI | InChI=1S/C23H29N5O3Si/c1-6-21(29)26-17-9-7-8-16(12-17)19-13-18-20(14-25-19)28(27-22(18)23(30)24-2)15-31-10-11-32(3,4)5/h6-9,12-14H,1,10-11,15H2,2-5H3,(H,24,30)(H,26,29) |
| InChIKey | VAACKJOOZQOSAO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|