C12H12N4O — CID 139018846
N-[3-(1-methyltriazol-4-yl)phenyl]prop-2-enamide (PubChem CID 139018846) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is N-[3-(1-methyltriazol-4-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(1-methyltriazol-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139018846 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-[3-(1-methyltriazol-4-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cn(C)nn2)c1 |
| InChI | InChI=1S/C12H12N4O/c1-3-12(17)13-10-6-4-5-9(7-10)11-8-16(2)15-14-11/h3-8H,1H2,2H3,(H,13,17) |
| InChIKey | ITRHYKBCFIQMII-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|