C12H12N6O — CID 131876477
N-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]prop-2-enamide (PubChem CID 131876477) has the molecular formula C12H12N6O and a molecular weight of 256.27 g/mol. Its IUPAC name is N-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 131876477 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-[3-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(N)nc(N)n2)c1 |
| InChI | InChI=1S/C12H12N6O/c1-2-9(19)15-8-5-3-4-7(6-8)10-16-11(13)18-12(14)17-10/h2-6H,1H2,(H,15,19)(H4,13,14,16,17,18) |
| InChIKey | DKXVGWGJXSWGJZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|