C36H28N6O2 — CID 166915143
N-[3-[6-amino-5-[2-amino-7-[3-(prop-2-enoylamino)phenyl]quinazolin-4-yl]naphthalen-2-yl]phenyl]prop-2-enamide (PubChem CID 166915143) has the molecular formula C36H28N6O2 and a molecular weight of 576.66 g/mol. Its IUPAC name is N-[3-[6-amino-5-[2-amino-7-[3-(prop-2-enoylamino)phenyl]quinazolin-4-yl]naphthalen-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-amino-5-[2-amino-7-[3-(prop-2-enoylamino)phenyl]quinazolin-4-yl]naphthalen-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166915143 |
| Molecular Formula | C36H28N6O2 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | N-[3-[6-amino-5-[2-amino-7-[3-(prop-2-enoylamino)phenyl]quinazolin-4-yl]naphthalen-2-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ccc3c(-c4nc(N)nc5cc(-c6cccc(NC(=O)C=C)c6)ccc45)c(N)ccc3c2)c1 |
| InChI | InChI=1S/C36H28N6O2/c1-3-32(43)39-26-9-5-7-21(18-26)23-11-14-28-25(17-23)13-16-30(37)34(28)35-29-15-12-24(20-31(29)41-36(38)42-35)22-8-6-10-27(19-22)40-33(44)4-2/h3-20H,1-2,37H2,(H,39,43)(H,40,44)(H2,38,41,42) |
| InChIKey | KOWGEZZCFFAMLZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|