C17H15N3O2 — CID 162527290
N-[3-(3-methoxy-1H-indazol-5-yl)phenyl]prop-2-enamide (PubChem CID 162527290) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[3-(3-methoxy-1H-indazol-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(3-methoxy-1H-indazol-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162527290 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[3-(3-methoxy-1H-indazol-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ccc3[nH]nc(OC)c3c2)c1 |
| InChI | InChI=1S/C17H15N3O2/c1-3-16(21)18-13-6-4-5-11(9-13)12-7-8-15-14(10-12)17(22-2)20-19-15/h3-10H,1H2,2H3,(H,18,21)(H,19,20) |
| InChIKey | CIRMFXKBPBTGOC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|