C17H17N4OP — CID 129189261
N-[3-(3-methyl-1-methylphosphanylpyrazolo[5,4-b]pyridin-5-yl)phenyl]prop-2-enamide (PubChem CID 129189261) has the molecular formula C17H17N4OP and a molecular weight of 324.32 g/mol. Its IUPAC name is N-[3-(3-methyl-1-methylphosphanylpyrazolo[5,4-b]pyridin-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(3-methyl-1-methylphosphanylpyrazolo[5,4-b]pyridin-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129189261 |
| Molecular Formula | C17H17N4OP |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[3-(3-methyl-1-methylphosphanylpyrazolo[5,4-b]pyridin-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc3c(c2)c(C)nn3PC)c1 |
| InChI | InChI=1S/C17H17N4OP/c1-4-16(22)19-14-7-5-6-12(8-14)13-9-15-11(2)20-21(23-3)17(15)18-10-13/h4-10,23H,1H2,2-3H3,(H,19,22) |
| InChIKey | AOOYYGZUFUCCDS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|