C31H33N7O2 — CID 175419875
N-[[4-[4-amino-6-[3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide (PubChem CID 175419875) has the molecular formula C31H33N7O2 and a molecular weight of 535.65 g/mol. Its IUPAC name is N-[[4-[4-amino-6-[3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide.
| Compound Name | N-[[4-[4-amino-6-[3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 175419875 |
| Molecular Formula | C31H33N7O2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | N-[[4-[4-amino-6-[3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(N)nc(-c3ccc(CNC(=O)c4ccc(C(C)(C)C)cc4)c(C)c3)n2)c1 |
| InChI | InChI=1S/C31H33N7O2/c1-6-26(39)34-24-8-7-9-25(17-24)35-30-37-27(36-29(32)38-30)21-10-11-22(19(2)16-21)18-33-28(40)20-12-14-23(15-13-20)31(3,4)5/h6-17H,1,18H2,2-5H3,(H,33,40)(H,34,39)(H3,32,35,36,37,38) |
| InChIKey | QULAUVRZJAEPLV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|