C31H32FN7O2 — CID 172749289
N-[[4-[4-amino-6-[4-fluoro-3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide (PubChem CID 172749289) has the molecular formula C31H32FN7O2 and a molecular weight of 553.64 g/mol. Its IUPAC name is N-[[4-[4-amino-6-[4-fluoro-3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide.
| Compound Name | N-[[4-[4-amino-6-[4-fluoro-3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 172749289 |
| Molecular Formula | C31H32FN7O2 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | N-[[4-[4-amino-6-[4-fluoro-3-(prop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]-2-methylphenyl]methyl]-4-tert-butylbenzamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nc(N)nc(-c3ccc(CNC(=O)c4ccc(C(C)(C)C)cc4)c(C)c3)n2)ccc1F |
| InChI | InChI=1S/C31H32FN7O2/c1-6-26(40)36-25-16-23(13-14-24(25)32)35-30-38-27(37-29(33)39-30)20-7-8-21(18(2)15-20)17-34-28(41)19-9-11-22(12-10-19)31(3,4)5/h6-16H,1,17H2,2-5H3,(H,34,41)(H,36,40)(H3,33,35,37,38,39) |
| InChIKey | KDPLNSUSOSXLRO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|