C19H21FN4O2 — CID 166407606
N-[5-[[2-(2-ethyl-4,6-dimethylpyrimidin-5-yl)acetyl]amino]-2-fluorophenyl]prop-2-enamide (PubChem CID 166407606) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[5-[[2-(2-ethyl-4,6-dimethylpyrimidin-5-yl)acetyl]amino]-2-fluorophenyl]prop-2-enamide.
| Compound Name | N-[5-[[2-(2-ethyl-4,6-dimethylpyrimidin-5-yl)acetyl]amino]-2-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407606 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[5-[[2-(2-ethyl-4,6-dimethylpyrimidin-5-yl)acetyl]amino]-2-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)Cc2c(C)nc(CC)nc2C)ccc1F |
| InChI | InChI=1S/C19H21FN4O2/c1-5-17-21-11(3)14(12(4)22-17)10-19(26)23-13-7-8-15(20)16(9-13)24-18(25)6-2/h6-9H,2,5,10H2,1,3-4H3,(H,23,26)(H,24,25) |
| InChIKey | URBVYPNTKHXUMK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|