C18H16FN3O4 — CID 166405352
N-[2-[4-fluoro-3-(prop-2-enoylamino)anilino]-2-oxoethyl]-3-hydroxybenzamide (PubChem CID 166405352) has the molecular formula C18H16FN3O4 and a molecular weight of 357.34 g/mol. Its IUPAC name is N-[2-[4-fluoro-3-(prop-2-enoylamino)anilino]-2-oxoethyl]-3-hydroxybenzamide.
| Compound Name | N-[2-[4-fluoro-3-(prop-2-enoylamino)anilino]-2-oxoethyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 166405352 |
| Molecular Formula | C18H16FN3O4 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[2-[4-fluoro-3-(prop-2-enoylamino)anilino]-2-oxoethyl]-3-hydroxybenzamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)CNC(=O)c2cccc(O)c2)ccc1F |
| InChI | InChI=1S/C18H16FN3O4/c1-2-16(24)22-15-9-12(6-7-14(15)19)21-17(25)10-20-18(26)11-4-3-5-13(23)8-11/h2-9,23H,1,10H2,(H,20,26)(H,21,25)(H,22,24) |
| InChIKey | SVYLYYYAIGUMAB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|