C16H11F2N3O2 — CID 7930152
3-cyano-N-[2-(3,4-difluoroanilino)-2-oxoethyl]benzamide (PubChem CID 7930152) has the molecular formula C16H11F2N3O2 and a molecular weight of 315.28 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,4-difluoroanilino)-2-oxoethyl]benzamide.
| Compound Name | 3-cyano-N-[2-(3,4-difluoroanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 7930152 |
| Molecular Formula | C16H11F2N3O2 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-cyano-N-[2-(3,4-difluoroanilino)-2-oxoethyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H11F2N3O2/c17-13-5-4-12(7-14(13)18)21-15(22)9-20-16(23)11-3-1-2-10(6-11)8-19/h1-7H,9H2,(H,20,23)(H,21,22) |
| InChIKey | CFWBIBZBKMMGAX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |