About 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide
4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide (PubChem CID 121250000) has the molecular formula C23H25FN4O
and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide |
| PubChem CID | 121250000 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccc(-c3ccnc(N)c3N)cc2F)cc1 |
| InChI | InChI=1S/C23H25FN4O/c1-23(2,3)17-8-6-14(7-9-17)22(29)28-13-16-5-4-15(12-19(16)24)18-10-11-27-21(26)20(18)25/h4-12H,13,25H2,1-3H3,(H2,26,27)(H,28,29) |
| InChIKey | HCWHLROYAOKENZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide?
The IUPAC name of 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide (CID 121250000) is 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide.
What is the SMILES notation for 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide?
The canonical SMILES for 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide is CC(C)(C)c1ccc(C(=O)NCc2ccc(-c3ccnc(N)c3N)cc2F)cc1.
What is the InChIKey of 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide?
The InChIKey is HCWHLROYAOKENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25FN4O/c1-23(2,3)17-8-6-14(7-9-17)22(29)28-13-16-5-4-15(12-19(16)24)18-10-11-27-21(26)20(18)25/h4-12H,13,25H2,1-3H3,(H2,26,27)(H,28,29).
What are the key properties of 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide?
4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide has a molecular weight of 392.48 g/mol, XLogP of 4.28, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[[4-(2,3-diamino-4-pyridinyl)-2-fluorophenyl]methyl]benzamide is sourced from PubChem (CID 121250000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).