C22H20F2N4O — CID 50848385
N-[(2,4-difluorophenyl)methyl]-4-(3-pyrrolidin-1-ylpyrazin-2-yl)benzamide (PubChem CID 50848385) has the molecular formula C22H20F2N4O and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-4-(3-pyrrolidin-1-ylpyrazin-2-yl)benzamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-4-(3-pyrrolidin-1-ylpyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 50848385 |
| Molecular Formula | C22H20F2N4O |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-4-(3-pyrrolidin-1-ylpyrazin-2-yl)benzamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1ccc(-c2nccnc2N2CCCC2)cc1 |
| InChI | InChI=1S/C22H20F2N4O/c23-18-8-7-17(19(24)13-18)14-27-22(29)16-5-3-15(4-6-16)20-21(26-10-9-25-20)28-11-1-2-12-28/h3-10,13H,1-2,11-12,14H2,(H,27,29) |
| InChIKey | AJBSNPRKTJFZPL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |