C14H10F2INO — CID 60739464
N-[(2,4-difluorophenyl)methyl]-4-iodobenzamide (PubChem CID 60739464) has the molecular formula C14H10F2INO and a molecular weight of 373.14 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-4-iodobenzamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 60739464 |
| Molecular Formula | C14H10F2INO |
| Molecular Weight | 373.14 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-4-iodobenzamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H10F2INO/c15-11-4-1-10(13(16)7-11)8-18-14(19)9-2-5-12(17)6-3-9/h1-7H,8H2,(H,18,19) |
| InChIKey | HPVPDVRLPXPDFB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.14 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|