C16H15F2NO3 — CID 110782194
N-[(2,4-difluorophenyl)methyl]-3,5-dimethoxybenzamide (PubChem CID 110782194) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 110782194 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H15F2NO3/c1-21-13-5-11(6-14(8-13)22-2)16(20)19-9-10-3-4-12(17)7-15(10)18/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | MMKBLESFDPSUFM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |