C21H20F2N5O2P — CID 154638111
N-[5-[[4-(2-dimethylphosphorylanilino)-5-fluoropyrimidin-2-yl]amino]-2-fluorophenyl]prop-2-enamide (PubChem CID 154638111) has the molecular formula C21H20F2N5O2P and a molecular weight of 443.39 g/mol. Its IUPAC name is N-[5-[[4-(2-dimethylphosphorylanilino)-5-fluoropyrimidin-2-yl]amino]-2-fluorophenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-(2-dimethylphosphorylanilino)-5-fluoropyrimidin-2-yl]amino]-2-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154638111 |
| Molecular Formula | C21H20F2N5O2P |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[5-[[4-(2-dimethylphosphorylanilino)-5-fluoropyrimidin-2-yl]amino]-2-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(F)c(Nc3ccccc3P(C)(C)=O)n2)ccc1F |
| InChI | InChI=1S/C21H20F2N5O2P/c1-4-19(29)26-17-11-13(9-10-14(17)22)25-21-24-12-15(23)20(28-21)27-16-7-5-6-8-18(16)31(2,3)30/h4-12H,1H2,2-3H3,(H,26,29)(H2,24,25,27,28) |
| InChIKey | WSGWFNUDZUVLNI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|